About 1-methoxypropan-2-yl 3-iodobenzoate
1-methoxypropan-2-yl 3-iodobenzoate (PubChem CID 71145343) has the molecular formula C11H13IO3
and a molecular weight of 320.13 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 3-iodobenzoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 3-iodobenzoate |
| PubChem CID | 71145343 |
| Molecular Formula | C11H13IO3 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 1-methoxypropan-2-yl 3-iodobenzoate |
| SMILES | COCC(C)OC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C11H13IO3/c1-8(7-14-2)15-11(13)9-4-3-5-10(12)6-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | RZWVXRHTNKXCGP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropan-2-yl 3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 3-iodobenzoate?
The IUPAC name of 1-methoxypropan-2-yl 3-iodobenzoate (CID 71145343) is 1-methoxypropan-2-yl 3-iodobenzoate.
What is the SMILES notation for 1-methoxypropan-2-yl 3-iodobenzoate?
The canonical SMILES for 1-methoxypropan-2-yl 3-iodobenzoate is COCC(C)OC(=O)c1cccc(I)c1.
What is the InChIKey of 1-methoxypropan-2-yl 3-iodobenzoate?
The InChIKey is RZWVXRHTNKXCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IO3/c1-8(7-14-2)15-11(13)9-4-3-5-10(12)6-9/h3-6,8H,7H2,1-2H3.
What are the key properties of 1-methoxypropan-2-yl 3-iodobenzoate?
1-methoxypropan-2-yl 3-iodobenzoate has a molecular weight of 320.13 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 3-iodobenzoate is sourced from PubChem (CID 71145343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).