About [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate
[2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate (PubChem CID 2394042) has the molecular formula C15H20INO3
and a molecular weight of 389.23 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate.
Molecular Properties
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate |
| PubChem CID | 2394042 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate |
| SMILES | CC(C)N(C(=O)COC(=O)c1cccc(I)c1)C(C)C |
| InChI | InChI=1S/C15H20INO3/c1-10(2)17(11(3)4)14(18)9-20-15(19)12-6-5-7-13(16)8-12/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | WBHVUFNMDXFKOZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate?
The IUPAC name of [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate (CID 2394042) is [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate.
What is the SMILES notation for [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate?
The canonical SMILES for [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate is CC(C)N(C(=O)COC(=O)c1cccc(I)c1)C(C)C.
What is the InChIKey of [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate?
The InChIKey is WBHVUFNMDXFKOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20INO3/c1-10(2)17(11(3)4)14(18)9-20-15(19)12-6-5-7-13(16)8-12/h5-8,10-11H,9H2,1-4H3.
What are the key properties of [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate?
[2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate has a molecular weight of 389.23 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-iodobenzoate is sourced from PubChem (CID 2394042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).