C13H13N3O — CID 116862122
4-(1,2-dimethylbenzimidazol-5-yl)-4-oxobutanenitrile (PubChem CID 116862122) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(1,2-dimethylbenzimidazol-5-yl)-4-oxobutanenitrile.
| Compound Name | 4-(1,2-dimethylbenzimidazol-5-yl)-4-oxobutanenitrile |
|---|---|
| PubChem CID | 116862122 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(1,2-dimethylbenzimidazol-5-yl)-4-oxobutanenitrile |
| SMILES | Cc1nc2cc(C(=O)CCC#N)ccc2n1C |
| InChI | InChI=1S/C13H13N3O/c1-9-15-11-8-10(13(17)4-3-7-14)5-6-12(11)16(9)2/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | CZVZRMZUTGLAJP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |