C16H22N4O — CID 94724130
1-(1,2-dimethylbenzimidazol-5-yl)-3-piperazin-1-ylpropan-1-one (PubChem CID 94724130) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(1,2-dimethylbenzimidazol-5-yl)-3-piperazin-1-ylpropan-1-one.
| Compound Name | 1-(1,2-dimethylbenzimidazol-5-yl)-3-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 94724130 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-(1,2-dimethylbenzimidazol-5-yl)-3-piperazin-1-ylpropan-1-one |
| SMILES | Cc1nc2cc(C(=O)CCN3CCNCC3)ccc2n1C |
| InChI | InChI=1S/C16H22N4O/c1-12-18-14-11-13(3-4-15(14)19(12)2)16(21)5-8-20-9-6-17-7-10-20/h3-4,11,17H,5-10H2,1-2H3 |
| InChIKey | YTIBPPUYRIHBTM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |