C15H22N4O — CID 110776234
1-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]-3-propan-2-ylurea (PubChem CID 110776234) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 110776234 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]-3-propan-2-ylurea |
| SMILES | Cc1nc2cc(CCNC(=O)NC(C)C)ccc2n1C |
| InChI | InChI=1S/C15H22N4O/c1-10(2)17-15(20)16-8-7-12-5-6-14-13(9-12)18-11(3)19(14)4/h5-6,9-10H,7-8H2,1-4H3,(H2,16,17,20) |
| InChIKey | WNCSEYVWTPHSAD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |