About 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol
2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol (PubChem CID 115133588) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol |
| PubChem CID | 115133588 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol |
| SMILES | Cc1nc2cc(CCNC(C)(C)CO)ccc2n1C |
| InChI | InChI=1S/C15H23N3O/c1-11-17-13-9-12(5-6-14(13)18(11)4)7-8-16-15(2,3)10-19/h5-6,9,16,19H,7-8,10H2,1-4H3 |
| InChIKey | JBSZZKYMTGZKJA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol?
The IUPAC name of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol (CID 115133588) is 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol.
What is the SMILES notation for 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol?
The canonical SMILES for 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol is Cc1nc2cc(CCNC(C)(C)CO)ccc2n1C.
What is the InChIKey of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol?
The InChIKey is JBSZZKYMTGZKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-11-17-13-9-12(5-6-14(13)18(11)4)7-8-16-15(2,3)10-19/h5-6,9,16,19H,7-8,10H2,1-4H3.
What are the key properties of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol?
2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol has a molecular weight of 261.37 g/mol, XLogP of 1.78, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]-2-methylpropan-1-ol is sourced from PubChem (CID 115133588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).