C15H24N4 — CID 115201448
N'-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]butane-1,4-diamine (PubChem CID 115201448) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is N'-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]butane-1,4-diamine.
| Compound Name | N'-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 115201448 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | N'-[2-(1,2-dimethylbenzimidazol-5-yl)ethyl]butane-1,4-diamine |
| SMILES | Cc1nc2cc(CCNCCCCN)ccc2n1C |
| InChI | InChI=1S/C15H24N4/c1-12-18-14-11-13(5-6-15(14)19(12)2)7-10-17-9-4-3-8-16/h5-6,11,17H,3-4,7-10,16H2,1-2H3 |
| InChIKey | YAUMACAWMMZOHE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|