About 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol
2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol (PubChem CID 115216317) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol |
| PubChem CID | 115216317 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol |
| SMILES | Cc1nc2cc(CCNCCO)ccc2n1C |
| InChI | InChI=1S/C13H19N3O/c1-10-15-12-9-11(5-6-14-7-8-17)3-4-13(12)16(10)2/h3-4,9,14,17H,5-8H2,1-2H3 |
| InChIKey | CIKCLQNMTDEGAR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol?
The IUPAC name of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol (CID 115216317) is 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol.
What is the SMILES notation for 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol?
The canonical SMILES for 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol is Cc1nc2cc(CCNCCO)ccc2n1C.
What is the InChIKey of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol?
The InChIKey is CIKCLQNMTDEGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-10-15-12-9-11(5-6-14-7-8-17)3-4-13(12)16(10)2/h3-4,9,14,17H,5-8H2,1-2H3.
What are the key properties of 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol?
2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol has a molecular weight of 233.31 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol is sourced from PubChem (CID 115216317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).