C13H19N3O — CID 115216317
2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol (PubChem CID 115216317) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol.
| Compound Name | 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 115216317 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]ethanol |
| SMILES | Cc1nc2cc(CCNCCO)ccc2n1C |
| InChI | InChI=1S/C13H19N3O/c1-10-15-12-9-11(5-6-14-7-8-17)3-4-13(12)16(10)2/h3-4,9,14,17H,5-8H2,1-2H3 |
| InChIKey | CIKCLQNMTDEGAR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|