C20H18F2N4O2 — CID 108573338
N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 108573338) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108573338 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[2-[(2,4-difluorobenzoyl)amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCCNC(=O)c3ccc(F)cc3F)cc2nc1C |
| InChI | InChI=1S/C20H18F2N4O2/c1-11-12(2)26-18-9-13(3-6-17(18)25-11)19(27)23-7-8-24-20(28)15-5-4-14(21)10-16(15)22/h3-6,9-10H,7-8H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | LUYLPTWNQYWZSI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|