C19H17F2N3O — CID 110795619
N-[2-(2,4-difluorophenyl)ethyl]-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 110795619) has the molecular formula C19H17F2N3O and a molecular weight of 341.36 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 110795619 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCCc3ccc(F)cc3F)cc2nc1C |
| InChI | InChI=1S/C19H17F2N3O/c1-11-12(2)24-18-9-14(4-6-17(18)23-11)19(25)22-8-7-13-3-5-15(20)10-16(13)21/h3-6,9-10H,7-8H2,1-2H3,(H,22,25) |
| InChIKey | WELXCTISHOGANY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |