C21H19F3N4O2 — CID 108542144
2,3-dimethyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]quinoxaline-6-carboxamide (PubChem CID 108542144) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2,3-dimethyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]quinoxaline-6-carboxamide.
| Compound Name | 2,3-dimethyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108542144 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2,3-dimethyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]quinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCCNC(=O)c3ccc(C(F)(F)F)cc3)cc2nc1C |
| InChI | InChI=1S/C21H19F3N4O2/c1-12-13(2)28-18-11-15(5-8-17(18)27-12)20(30)26-10-9-25-19(29)14-3-6-16(7-4-14)21(22,23)24/h3-8,11H,9-10H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | KWRBUEOMUCERTJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|