C17H18N4O3S2 — CID 108573350
2,3-dimethyl-N-[2-(thiophen-2-ylsulfonylamino)ethyl]quinoxaline-6-carboxamide (PubChem CID 108573350) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2,3-dimethyl-N-[2-(thiophen-2-ylsulfonylamino)ethyl]quinoxaline-6-carboxamide.
| Compound Name | 2,3-dimethyl-N-[2-(thiophen-2-ylsulfonylamino)ethyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108573350 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2,3-dimethyl-N-[2-(thiophen-2-ylsulfonylamino)ethyl]quinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCCNS(=O)(=O)c3cccs3)cc2nc1C |
| InChI | InChI=1S/C17H18N4O3S2/c1-11-12(2)21-15-10-13(5-6-14(15)20-11)17(22)18-7-8-19-26(23,24)16-4-3-9-25-16/h3-6,9-10,19H,7-8H2,1-2H3,(H,18,22) |
| InChIKey | USCNDTCKYKALBY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|