C21H21N4OS2+ — CID 3713317
2-[(2,3-dithiophen-2-ylquinoxaline-6-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 3713317) has the molecular formula C21H21N4OS2+ and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[(2,3-dithiophen-2-ylquinoxaline-6-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(2,3-dithiophen-2-ylquinoxaline-6-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 3713317 |
| Molecular Formula | C21H21N4OS2+ |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-[(2,3-dithiophen-2-ylquinoxaline-6-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)c1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C21H20N4OS2/c1-25(2)10-9-22-21(26)14-7-8-15-16(13-14)24-20(18-6-4-12-28-18)19(23-15)17-5-3-11-27-17/h3-8,11-13H,9-10H2,1-2H3,(H,22,26)/p+1 |
| InChIKey | ZWVRXKNDEUZTTG-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |