C25H17N3O3S2 — CID 1329977
N-(1,3-benzodioxol-5-ylmethyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide (PubChem CID 1329977) has the molecular formula C25H17N3O3S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 1329977 |
| Molecular Formula | C25H17N3O3S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C25H17N3O3S2/c29-25(26-13-15-5-8-19-20(11-15)31-14-30-19)16-6-7-17-18(12-16)28-24(22-4-2-10-33-22)23(27-17)21-3-1-9-32-21/h1-12H,13-14H2,(H,26,29) |
| InChIKey | QZWQQNANDXPNJV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |