C26H23N3OS2 — CID 142989785
N-(3-cyclohexa-1,5-dien-1-ylpropyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide (PubChem CID 142989785) has the molecular formula C26H23N3OS2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-(3-cyclohexa-1,5-dien-1-ylpropyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide.
| Compound Name | N-(3-cyclohexa-1,5-dien-1-ylpropyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 142989785 |
| Molecular Formula | C26H23N3OS2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-(3-cyclohexa-1,5-dien-1-ylpropyl)-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
| SMILES | O=C(NCCCC1=CCCC=C1)c1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C26H23N3OS2/c30-26(27-14-4-9-18-7-2-1-3-8-18)19-12-13-20-21(17-19)29-25(23-11-6-16-32-23)24(28-20)22-10-5-15-31-22/h2,5-8,10-13,15-17H,1,3-4,9,14H2,(H,27,30) |
| InChIKey | FJGLUNVMJSXIFC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|