C22H14N4OS2 — CID 2300708
N-pyridin-3-yl-2,3-dithiophen-2-ylquinoxaline-6-carboxamide (PubChem CID 2300708) has the molecular formula C22H14N4OS2 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-pyridin-3-yl-2,3-dithiophen-2-ylquinoxaline-6-carboxamide.
| Compound Name | N-pyridin-3-yl-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2300708 |
| Molecular Formula | C22H14N4OS2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-pyridin-3-yl-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccc2nc(-c3cccs3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C22H14N4OS2/c27-22(24-15-4-1-9-23-13-15)14-7-8-16-17(12-14)26-21(19-6-3-11-29-19)20(25-16)18-5-2-10-28-18/h1-13H,(H,24,27) |
| InChIKey | UMCMIMKYFLBDNK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |