C22H16N6O — CID 4253586
N-pyridin-3-yl-2,3-bis(1H-pyrrol-2-yl)quinoxaline-6-carboxamide (PubChem CID 4253586) has the molecular formula C22H16N6O and a molecular weight of 380.41 g/mol. Its IUPAC name is N-pyridin-3-yl-2,3-bis(1H-pyrrol-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-pyridin-3-yl-2,3-bis(1H-pyrrol-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 4253586 |
| Molecular Formula | C22H16N6O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-pyridin-3-yl-2,3-bis(1H-pyrrol-2-yl)quinoxaline-6-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc2c1 |
| InChI | InChI=1S/C22H16N6O/c29-22(26-15-4-1-9-23-13-15)14-7-8-16-19(12-14)28-21(18-6-3-11-25-18)20(27-16)17-5-2-10-24-17/h1-13,24-25H,(H,26,29) |
| InChIKey | TZQJDHCPPGPAPL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |