C46H36N6O2S4 — CID 177047252
N-[2-[4-[5-[6-(butylcarbamoyl)-3-thiophen-2-ylquinoxalin-2-yl]thiophen-2-yl]phenyl]ethyl]-2,3-dithiophen-2-ylquinoxaline-6-carboxamide (PubChem CID 177047252) has the molecular formula C46H36N6O2S4 and a molecular weight of 833.10 g/mol. Its IUPAC name is N-[2-[4-[5-[6-(butylcarbamoyl)-3-thiophen-2-ylquinoxalin-2-yl]thiophen-2-yl]phenyl]ethyl]-2,3-dithiophen-2-ylquinoxaline-6-carboxamide.
| Compound Name | N-[2-[4-[5-[6-(butylcarbamoyl)-3-thiophen-2-ylquinoxalin-2-yl]thiophen-2-yl]phenyl]ethyl]-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 177047252 |
| Molecular Formula | C46H36N6O2S4 |
| Molecular Weight | 833.10 g/mol |
| Exact Mass | 832.18 |
| IUPAC Name | N-[2-[4-[5-[6-(butylcarbamoyl)-3-thiophen-2-ylquinoxalin-2-yl]thiophen-2-yl]phenyl]ethyl]-2,3-dithiophen-2-ylquinoxaline-6-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2nc(-c3ccc(-c4ccc(CCNC(=O)c5ccc6nc(-c7cccs7)c(-c7cccs7)nc6c5)cc4)s3)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C46H36N6O2S4/c1-2-3-21-47-45(53)30-14-17-33-35(26-30)52-43(39-9-6-25-57-39)44(50-33)40-19-18-36(58-40)29-12-10-28(11-13-29)20-22-48-46(54)31-15-16-32-34(27-31)51-42(38-8-5-24-56-38)41(49-32)37-7-4-23-55-37/h4-19,23-27H,2-3,20-22H2,1H3,(H,47,53)(H,48,54) |
| InChIKey | PYFMVYAUEJZAIK-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.10 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|