C19H23N4O2S+ — CID 7250102
2-[[1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 7250102) has the molecular formula C19H23N4O2S+ and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-[[1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7250102 |
| Molecular Formula | C19H23N4O2S+ |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[[1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | COc1ccc(-n2nc(-c3cccs3)cc2C(=O)NCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C19H22N4O2S/c1-22(2)11-10-20-19(24)17-13-16(18-5-4-12-26-18)21-23(17)14-6-8-15(25-3)9-7-14/h4-9,12-13H,10-11H2,1-3H3,(H,20,24)/p+1 |
| InChIKey | JFNBPNVEOMHUSS-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |