C15H11N2O3S- — CID 6946083
1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carboxylate (PubChem CID 6946083) has the molecular formula C15H11N2O3S- and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carboxylate.
| Compound Name | 1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 6946083 |
| Molecular Formula | C15H11N2O3S- |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-thiophen-2-ylpyrazole-5-carboxylate |
| SMILES | COc1ccc(-n2nc(-c3cccs3)cc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N2O3S/c1-20-11-6-4-10(5-7-11)17-13(15(18)19)9-12(16-17)14-3-2-8-21-14/h2-9H,1H3,(H,18,19)/p-1 |
| InChIKey | ABPMZZSMJFDSFW-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |