C13H13IN2O3S2 — CID 108571250
2-iodo-N-[2-(thiophen-2-ylsulfonylamino)ethyl]benzamide (PubChem CID 108571250) has the molecular formula C13H13IN2O3S2 and a molecular weight of 436.30 g/mol. Its IUPAC name is 2-iodo-N-[2-(thiophen-2-ylsulfonylamino)ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-(thiophen-2-ylsulfonylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108571250 |
| Molecular Formula | C13H13IN2O3S2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 2-iodo-N-[2-(thiophen-2-ylsulfonylamino)ethyl]benzamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccs1)c1ccccc1I |
| InChI | InChI=1S/C13H13IN2O3S2/c14-11-5-2-1-4-10(11)13(17)15-7-8-16-21(18,19)12-6-3-9-20-12/h1-6,9,16H,7-8H2,(H,15,17) |
| InChIKey | ITXPYSWWHFBERI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|