C7H8NO4S2- — CID 3420084
3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 3420084) has the molecular formula C7H8NO4S2- and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 3420084 |
| Molecular Formula | C7H8NO4S2- |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | O=C([O-])CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C7H9NO4S2/c9-6(10)3-4-8-14(11,12)7-2-1-5-13-7/h1-2,5,8H,3-4H2,(H,9,10)/p-1 |
| InChIKey | PGHCOXJSXMMPHU-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |