C11H16N2O5S2 — CID 62626367
2-[methyl-[3-(thiophen-2-ylsulfonylamino)propanoyl]amino]propanoic acid (PubChem CID 62626367) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[methyl-[3-(thiophen-2-ylsulfonylamino)propanoyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[3-(thiophen-2-ylsulfonylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 62626367 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[methyl-[3-(thiophen-2-ylsulfonylamino)propanoyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-8(11(15)16)13(2)9(14)5-6-12-20(17,18)10-4-3-7-19-10/h3-4,7-8,12H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | FRTZKOXHVFLGIL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |