C18H22N2O5S2 — CID 7836966
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 7836966) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7836966 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | CC(C)N(C(=O)COC(=O)CCNS(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-14(2)20(15-7-4-3-5-8-15)16(21)13-25-17(22)10-11-19-27(23,24)18-9-6-12-26-18/h3-9,12,14,19H,10-11,13H2,1-2H3 |
| InChIKey | ZQNPMDXFXGPQRU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |