C17H20N2O5S2 — CID 55705138
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 55705138) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 55705138 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | CC(C)N(C(=O)COC(=O)CNS(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-13(2)19(14-7-4-3-5-8-14)15(20)12-24-16(21)11-18-26(22,23)17-9-6-10-25-17/h3-10,13,18H,11-12H2,1-2H3 |
| InChIKey | WKCWBSHFZPWRBG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |