C17H20N2O5S2 — CID 7837000
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 7837000) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7837000 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCNS(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-13(14-6-3-2-4-7-14)19-15(20)12-24-16(21)9-10-18-26(22,23)17-8-5-11-25-17/h2-8,11,13,18H,9-10,12H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | GXAYAPCUUWVREI-ZDUSSCGKSA-N |
| XLogP | 1.84 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |