C12H18N2O5S2 — CID 81065023
3-methyl-4-[3-(thiophen-2-ylsulfonylamino)propanoylamino]butanoic acid (PubChem CID 81065023) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-methyl-4-[3-(thiophen-2-ylsulfonylamino)propanoylamino]butanoic acid.
| Compound Name | 3-methyl-4-[3-(thiophen-2-ylsulfonylamino)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 81065023 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-methyl-4-[3-(thiophen-2-ylsulfonylamino)propanoylamino]butanoic acid |
| SMILES | CC(CNC(=O)CCNS(=O)(=O)c1cccs1)CC(=O)O |
| InChI | InChI=1S/C12H18N2O5S2/c1-9(7-11(16)17)8-13-10(15)4-5-14-21(18,19)12-3-2-6-20-12/h2-3,6,9,14H,4-5,7-8H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | KKJUFQGTHSIRIT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |