C12H20N2O5S2 — CID 103850899
N-(4-hydroxy-1-methoxybutan-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 103850899) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(4-hydroxy-1-methoxybutan-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(4-hydroxy-1-methoxybutan-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 103850899 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-(4-hydroxy-1-methoxybutan-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | COCC(CCO)NC(=O)CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-19-9-10(5-7-15)14-11(16)4-6-13-21(17,18)12-3-2-8-20-12/h2-3,8,10,13,15H,4-7,9H2,1H3,(H,14,16) |
| InChIKey | LVFLCNBMWUFFSW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |