C14H21NO5S — CID 103851039
3-(benzenesulfonyl)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide (PubChem CID 103851039) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide |
|---|---|
| PubChem CID | 103851039 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide |
| SMILES | COCC(CCO)NC(=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO5S/c1-20-11-12(7-9-16)15-14(17)8-10-21(18,19)13-5-3-2-4-6-13/h2-6,12,16H,7-11H2,1H3,(H,15,17) |
| InChIKey | PGJYZTYTQZAAGR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |