C13H17NO5S — CID 60638125
methyl 2-[3-(benzenesulfonyl)propanoylamino]propanoate (PubChem CID 60638125) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl 2-[3-(benzenesulfonyl)propanoylamino]propanoate.
| Compound Name | methyl 2-[3-(benzenesulfonyl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 60638125 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 2-[3-(benzenesulfonyl)propanoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO5S/c1-10(13(16)19-2)14-12(15)8-9-20(17,18)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,14,15) |
| InChIKey | LDRDEXZCSYGFIM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |