C22H27NO5S — CID 155703471
benzyl (2S)-2-[3-(benzenesulfonyl)propanoylamino]-4-methylpentanoate (PubChem CID 155703471) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is benzyl (2S)-2-[3-(benzenesulfonyl)propanoylamino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[3-(benzenesulfonyl)propanoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 155703471 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | benzyl (2S)-2-[3-(benzenesulfonyl)propanoylamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)CCS(=O)(=O)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO5S/c1-17(2)15-20(22(25)28-16-18-9-5-3-6-10-18)23-21(24)13-14-29(26,27)19-11-7-4-8-12-19/h3-12,17,20H,13-16H2,1-2H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | WYZSTJGYPZJPAC-FQEVSTJZSA-N |
| XLogP | 3.12 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |