C23H27NO4 — CID 10894222
benzyl (2S)-4-methyl-2-[(2-oxo-4-phenylbutanoyl)amino]pentanoate (PubChem CID 10894222) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is benzyl (2S)-4-methyl-2-[(2-oxo-4-phenylbutanoyl)amino]pentanoate.
| Compound Name | benzyl (2S)-4-methyl-2-[(2-oxo-4-phenylbutanoyl)amino]pentanoate |
|---|---|
| PubChem CID | 10894222 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | benzyl (2S)-4-methyl-2-[(2-oxo-4-phenylbutanoyl)amino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C(=O)CCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-17(2)15-20(23(27)28-16-19-11-7-4-8-12-19)24-22(26)21(25)14-13-18-9-5-3-6-10-18/h3-12,17,20H,13-16H2,1-2H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | CSVBJVZUSDZVMY-FQEVSTJZSA-N |
| XLogP | 3.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|