C13H17NO4 — CID 113257886
methyl (2R)-2-(3-phenoxypropanoylamino)propanoate (PubChem CID 113257886) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl (2R)-2-(3-phenoxypropanoylamino)propanoate.
| Compound Name | methyl (2R)-2-(3-phenoxypropanoylamino)propanoate |
|---|---|
| PubChem CID | 113257886 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl (2R)-2-(3-phenoxypropanoylamino)propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c1-10(13(16)17-2)14-12(15)8-9-18-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | QLSSWKKLACCYBJ-SNVBAGLBSA-N |
| XLogP | 1.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |