C15H21NO4 — CID 87040329
methyl (2S)-2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate (PubChem CID 87040329) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl (2S)-2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate.
| Compound Name | methyl (2S)-2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate |
|---|---|
| PubChem CID | 87040329 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl (2S)-2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H21NO4/c1-10-7-11(2)9-13(8-10)20-6-5-14(17)16-12(3)15(18)19-4/h7-9,12H,5-6H2,1-4H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | AXBIHBQXIXUENG-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |