C13H19NO3 — CID 63041209
methyl 2-amino-4-(3,5-dimethylphenoxy)butanoate (PubChem CID 63041209) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-amino-4-(3,5-dimethylphenoxy)butanoate.
| Compound Name | methyl 2-amino-4-(3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 63041209 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl 2-amino-4-(3,5-dimethylphenoxy)butanoate |
| SMILES | COC(=O)C(N)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H19NO3/c1-9-6-10(2)8-11(7-9)17-5-4-12(14)13(15)16-3/h6-8,12H,4-5,14H2,1-3H3 |
| InChIKey | JLXMYRXFPNQFOC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |