C15H23NO2 — CID 60731427
N-tert-butyl-3-(3,5-dimethylphenoxy)propanamide (PubChem CID 60731427) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-tert-butyl-3-(3,5-dimethylphenoxy)propanamide.
| Compound Name | N-tert-butyl-3-(3,5-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 60731427 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-tert-butyl-3-(3,5-dimethylphenoxy)propanamide |
| SMILES | Cc1cc(C)cc(OCCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-11-8-12(2)10-13(9-11)18-7-6-14(17)16-15(3,4)5/h8-10H,6-7H2,1-5H3,(H,16,17) |
| InChIKey | RTVDLTQQVYYSEA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |