C16H23NO4 — CID 61344778
ethyl 2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate (PubChem CID 61344778) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl 2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate.
| Compound Name | ethyl 2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate |
|---|---|
| PubChem CID | 61344778 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 2-[3-(3,5-dimethylphenoxy)propanoylamino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H23NO4/c1-5-20-16(19)13(4)17-15(18)6-7-21-14-9-11(2)8-12(3)10-14/h8-10,13H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | LBIJRXOBDAOJII-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |