C16H18N4O3S2 — CID 18116342
N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 18116342) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 18116342 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | C[C@H](NC(=O)CCNS(=O)(=O)c1cccs1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H18N4O3S2/c1-11(16-19-12-5-2-3-6-13(12)20-16)18-14(21)8-9-17-25(22,23)15-7-4-10-24-15/h2-7,10-11,17H,8-9H2,1H3,(H,18,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | ICVXSVKJDPYYGH-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |