C20H22N4O3S — CID 18116527
N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide (PubChem CID 18116527) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 18116527 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
| SMILES | C[C@H](NC(=O)CCNS(=O)(=O)/C=C/c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H22N4O3S/c1-15(20-23-17-9-5-6-10-18(17)24-20)22-19(25)11-13-21-28(26,27)14-12-16-7-3-2-4-8-16/h2-10,12,14-15,21H,11,13H2,1H3,(H,22,25)(H,23,24)/b14-12+/t15-/m0/s1 |
| InChIKey | LRMDHBRRSWAGIQ-ZQHYZAEZSA-N |
| XLogP | 2.72 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |