C18H18N4O3S — CID 27649780
N-(1H-benzimidazol-2-yl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide (PubChem CID 27649780) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 27649780 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)/C=C/c1ccccc1)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H18N4O3S/c23-17(22-18-20-15-8-4-5-9-16(15)21-18)10-12-19-26(24,25)13-11-14-6-2-1-3-7-14/h1-9,11,13,19H,10,12H2,(H2,20,21,22,23)/b13-11+ |
| InChIKey | UABBFSAIZGEZTI-ACCUITESSA-N |
| XLogP | 2.48 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |