C17H17BrN2O4S — CID 60513205
N-(4-bromo-2-hydroxyphenyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide (PubChem CID 60513205) has the molecular formula C17H17BrN2O4S and a molecular weight of 425.30 g/mol. Its IUPAC name is N-(4-bromo-2-hydroxyphenyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide.
| Compound Name | N-(4-bromo-2-hydroxyphenyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 60513205 |
| Molecular Formula | C17H17BrN2O4S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | N-(4-bromo-2-hydroxyphenyl)-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)/C=C/c1ccccc1)Nc1ccc(Br)cc1O |
| InChI | InChI=1S/C17H17BrN2O4S/c18-14-6-7-15(16(21)12-14)20-17(22)8-10-19-25(23,24)11-9-13-4-2-1-3-5-13/h1-7,9,11-12,19,21H,8,10H2,(H,20,22)/b11-9+ |
| InChIKey | NLRCKJDKBBZHGE-PKNBQFBNSA-N |
| XLogP | 3.07 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|