C18H21BrN2O4S — CID 60513132
N-(4-bromo-2-hydroxyphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide (PubChem CID 60513132) has the molecular formula C18H21BrN2O4S and a molecular weight of 441.35 g/mol. Its IUPAC name is N-(4-bromo-2-hydroxyphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(4-bromo-2-hydroxyphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 60513132 |
| Molecular Formula | C18H21BrN2O4S |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | N-(4-bromo-2-hydroxyphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCC(=O)Nc2ccc(Br)cc2O)c(C)c1 |
| InChI | InChI=1S/C18H21BrN2O4S/c1-11-8-12(2)18(13(3)9-11)26(24,25)20-7-6-17(23)21-15-5-4-14(19)10-16(15)22/h4-5,8-10,20,22H,6-7H2,1-3H3,(H,21,23) |
| InChIKey | AKCYQOWXUGCQDJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|