C11H18N2O3S2 — CID 108573837
N-[2-(thiophen-2-ylsulfonylamino)ethyl]pentanamide (PubChem CID 108573837) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-[2-(thiophen-2-ylsulfonylamino)ethyl]pentanamide.
| Compound Name | N-[2-(thiophen-2-ylsulfonylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 108573837 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[2-(thiophen-2-ylsulfonylamino)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-2-3-5-10(14)12-7-8-13-18(15,16)11-6-4-9-17-11/h4,6,9,13H,2-3,5,7-8H2,1H3,(H,12,14) |
| InChIKey | RNPJHMCXPBBIHX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|