C15H18N2O4S2 — CID 108573563
3-phenoxy-N-[2-(thiophen-2-ylsulfonylamino)ethyl]propanamide (PubChem CID 108573563) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-phenoxy-N-[2-(thiophen-2-ylsulfonylamino)ethyl]propanamide.
| Compound Name | 3-phenoxy-N-[2-(thiophen-2-ylsulfonylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 108573563 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-phenoxy-N-[2-(thiophen-2-ylsulfonylamino)ethyl]propanamide |
| SMILES | O=C(CCOc1ccccc1)NCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H18N2O4S2/c18-14(8-11-21-13-5-2-1-3-6-13)16-9-10-17-23(19,20)15-7-4-12-22-15/h1-7,12,17H,8-11H2,(H,16,18) |
| InChIKey | AQYBRWNEABHKFN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|