C16H19NO5S2 — CID 55320518
2-(3-methylphenoxy)ethyl 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 55320518) has the molecular formula C16H19NO5S2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | 2-(3-methylphenoxy)ethyl 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 55320518 |
| Molecular Formula | C16H19NO5S2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | Cc1cccc(OCCOC(=O)CCNS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H19NO5S2/c1-13-4-2-5-14(12-13)21-9-10-22-15(18)7-8-17-24(19,20)16-6-3-11-23-16/h2-6,11-12,17H,7-10H2,1H3 |
| InChIKey | VEZQTQFORANGOS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|