C19H23NO5S — CID 7234461
2-(3-methylphenoxy)ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]acetate (PubChem CID 7234461) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]acetate.
| Compound Name | 2-(3-methylphenoxy)ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7234461 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]acetate |
| SMILES | Cc1cccc(OCCOC(=O)CNS(=O)(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H23NO5S/c1-14-5-4-6-17(11-14)24-9-10-25-19(21)13-20-26(22,23)18-8-7-15(2)16(3)12-18/h4-8,11-12,20H,9-10,13H2,1-3H3 |
| InChIKey | JSFMADVJYMYODX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|