C8H11NO5S2 — CID 79457092
2-[2-(thiophen-2-ylsulfonylamino)ethoxy]acetic acid (PubChem CID 79457092) has the molecular formula C8H11NO5S2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[2-(thiophen-2-ylsulfonylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(thiophen-2-ylsulfonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457092 |
| Molecular Formula | C8H11NO5S2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-[2-(thiophen-2-ylsulfonylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C8H11NO5S2/c10-7(11)6-14-4-3-9-16(12,13)8-2-1-5-15-8/h1-2,5,9H,3-4,6H2,(H,10,11) |
| InChIKey | OOXCARDYVFCTRO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|