C18H17NO6S2 — CID 2468453
[2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 2468453) has the molecular formula C18H17NO6S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 2468453 |
| Molecular Formula | C18H17NO6S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | Cc1c(C(=O)COC(=O)CCNS(=O)(=O)c2cccs2)oc2ccccc12 |
| InChI | InChI=1S/C18H17NO6S2/c1-12-13-5-2-3-6-15(13)25-18(12)14(20)11-24-16(21)8-9-19-27(22,23)17-7-4-10-26-17/h2-7,10,19H,8-9,11H2,1H3 |
| InChIKey | VNTAVNOIZNBDRE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |