C21H16F3NO5 — CID 31228854
[2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 31228854) has the molecular formula C21H16F3NO5 and a molecular weight of 419.36 g/mol. Its IUPAC name is [2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 31228854 |
| Molecular Formula | C21H16F3NO5 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2-(3-methyl-1-benzofuran-2-yl)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | Cc1c(C(=O)COC(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H16F3NO5/c1-12-15-4-2-3-5-17(15)30-19(12)16(26)11-29-18(27)10-25-20(28)13-6-8-14(9-7-13)21(22,23)24/h2-9H,10-11H2,1H3,(H,25,28) |
| InChIKey | LCBULBMTVRTHPJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |