C18H23F3N2O4 — CID 7880432
[2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 7880432) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7880432 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | CC(C)N(C(=O)COC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C18H23F3N2O4/c1-11(2)23(12(3)4)15(24)10-27-16(25)9-22-17(26)13-5-7-14(8-6-13)18(19,20)21/h5-8,11-12H,9-10H2,1-4H3,(H,22,26) |
| InChIKey | SBOZMVFRPQLZRJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |